C15H22F2O5S — CID 88529207
2-[2-(1-adamantyl)acetyl]oxy-1,1-difluoropropane-1-sulfonic acid (PubChem CID 88529207) has the molecular formula C15H22F2O5S and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[2-(1-adamantyl)acetyl]oxy-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-[2-(1-adamantyl)acetyl]oxy-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88529207 |
| Molecular Formula | C15H22F2O5S |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[2-(1-adamantyl)acetyl]oxy-1,1-difluoropropane-1-sulfonic acid |
| SMILES | CC(OC(=O)CC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C15H22F2O5S/c1-9(15(16,17)23(19,20)21)22-13(18)8-14-5-10-2-11(6-14)4-12(3-10)7-14/h9-12H,2-8H2,1H3,(H,19,20,21) |
| InChIKey | IHHCZKCEKLSYSU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|