C19H23F5O6S — CID 129070122
1,1,3,3,3-pentafluoro-2-[3-(3-methyl-2-oxobut-3-enyl)adamantane-1-carbonyl]oxypropane-1-sulfonic acid (PubChem CID 129070122) has the molecular formula C19H23F5O6S and a molecular weight of 474.44 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[3-(3-methyl-2-oxobut-3-enyl)adamantane-1-carbonyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[3-(3-methyl-2-oxobut-3-enyl)adamantane-1-carbonyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070122 |
| Molecular Formula | C19H23F5O6S |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[3-(3-methyl-2-oxobut-3-enyl)adamantane-1-carbonyl]oxypropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)CC12CC3CC(C1)CC(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C19H23F5O6S/c1-10(2)13(25)8-16-4-11-3-12(5-16)7-17(6-11,9-16)15(26)30-14(18(20,21)22)19(23,24)31(27,28)29/h11-12,14H,1,3-9H2,2H3,(H,27,28,29) |
| InChIKey | PLFFVTIGAQMCHU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|