C36H34F5NO7S2 — CID 159318178
1,1,3,3,3-pentafluoro-2-[3-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxypropane-1-sulfonate;5-phenyl-10H-phenothiazin-5-ium (PubChem CID 159318178) has the molecular formula C36H34F5NO7S2 and a molecular weight of 751.79 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[3-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxypropane-1-sulfonate;5-phenyl-10H-phenothiazin-5-ium.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[3-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxypropane-1-sulfonate;5-phenyl-10H-phenothiazin-5-ium |
|---|---|
| PubChem CID | 159318178 |
| Molecular Formula | C36H34F5NO7S2 |
| Molecular Weight | 751.79 g/mol |
| Exact Mass | 751.17 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[3-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxypropane-1-sulfonate;5-phenyl-10H-phenothiazin-5-ium |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])(C3)C2.c1ccc([S+]2c3ccccc3Nc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21F5O7S.C18H14NS/c1-9(2)12(24)30-16-6-10-3-11(7-16)5-15(4-10,8-16)14(25)29-13(17(19,20)21)18(22,23)31(26,27)28;1-2-8-14(9-3-1)20-17-12-6-4-10-15(17)19-16-11-5-7-13-18(16)20/h10-11,13H,1,3-8H2,2H3,(H,26,27,28);1-13,19H/q;+1/p-1 |
| InChIKey | LDKMZEXTUOFCRM-UHFFFAOYSA-M |
| XLogP | 7.90 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.79 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|