C35H33F5O8S2 — CID 123700404
[1-[dihydroxy-oxo-(5-phenyldibenzothiophen-5-yl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 3-(2-oxopropanoyloxy)adamantane-1-carboxylate (PubChem CID 123700404) has the molecular formula C35H33F5O8S2 and a molecular weight of 740.77 g/mol. Its IUPAC name is [1-[dihydroxy-oxo-(5-phenyldibenzothiophen-5-yl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 3-(2-oxopropanoyloxy)adamantane-1-carboxylate.
| Compound Name | [1-[dihydroxy-oxo-(5-phenyldibenzothiophen-5-yl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 3-(2-oxopropanoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 123700404 |
| Molecular Formula | C35H33F5O8S2 |
| Molecular Weight | 740.77 g/mol |
| Exact Mass | 740.15 |
| IUPAC Name | [1-[dihydroxy-oxo-(5-phenyldibenzothiophen-5-yl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 3-(2-oxopropanoyloxy)adamantane-1-carboxylate |
| SMILES | CC(=O)C(=O)OC12CC3CC(C1)CC(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(O)(O)S1(c4ccccc4)c4ccccc4-c4ccccc41)(C3)C2 |
| InChI | InChI=1S/C35H33F5O8S2/c1-21(41)29(42)48-33-18-22-15-23(19-33)17-32(16-22,20-33)31(43)47-30(34(36,37)38)35(39,40)50(44,45,46)49(24-9-3-2-4-10-24)27-13-7-5-11-25(27)26-12-6-8-14-28(26)49/h2-14,22-23,30H,15-20H2,1H3,(H2,44,45,46) |
| InChIKey | NCBPRBIPEDBCQM-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.77 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|