C19H25F2O6- — CID 164747312
3-(3-acetyloxyadamantane-1-carbonyl)oxy-2,2-difluoro-4-methylpentanoate (PubChem CID 164747312) has the molecular formula C19H25F2O6- and a molecular weight of 387.40 g/mol. Its IUPAC name is 3-(3-acetyloxyadamantane-1-carbonyl)oxy-2,2-difluoro-4-methylpentanoate.
| Compound Name | 3-(3-acetyloxyadamantane-1-carbonyl)oxy-2,2-difluoro-4-methylpentanoate |
|---|---|
| PubChem CID | 164747312 |
| Molecular Formula | C19H25F2O6- |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-(3-acetyloxyadamantane-1-carbonyl)oxy-2,2-difluoro-4-methylpentanoate |
| SMILES | CC(=O)OC12CC3CC(C1)CC(C(=O)OC(C(C)C)C(F)(F)C(=O)[O-])(C3)C2 |
| InChI | InChI=1S/C19H26F2O6/c1-10(2)14(19(20,21)15(23)24)26-16(25)17-5-12-4-13(6-17)8-18(7-12,9-17)27-11(3)22/h10,12-14H,4-9H2,1-3H3,(H,23,24)/p-1 |
| InChIKey | ZCALLNLWJMPKDT-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |