C14H19F3O3 — CID 118258801
1,1,1-trifluoropropan-2-yl 3-hydroxyadamantane-1-carboxylate (PubChem CID 118258801) has the molecular formula C14H19F3O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 3-hydroxyadamantane-1-carboxylate.
| Compound Name | 1,1,1-trifluoropropan-2-yl 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 118258801 |
| Molecular Formula | C14H19F3O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 3-hydroxyadamantane-1-carboxylate |
| SMILES | CC(OC(=O)C12CC3CC(CC(O)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C14H19F3O3/c1-8(14(15,16)17)20-11(18)12-3-9-2-10(4-12)6-13(19,5-9)7-12/h8-10,19H,2-7H2,1H3 |
| InChIKey | DJNSLCLMNQEAEZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |