C13H18F2O3S — CID 148762586
(2,2-difluoro-2-sulfanylethyl) 3-hydroxyadamantane-1-carboxylate (PubChem CID 148762586) has the molecular formula C13H18F2O3S and a molecular weight of 292.35 g/mol. Its IUPAC name is (2,2-difluoro-2-sulfanylethyl) 3-hydroxyadamantane-1-carboxylate.
| Compound Name | (2,2-difluoro-2-sulfanylethyl) 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 148762586 |
| Molecular Formula | C13H18F2O3S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (2,2-difluoro-2-sulfanylethyl) 3-hydroxyadamantane-1-carboxylate |
| SMILES | O=C(OCC(F)(F)S)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C13H18F2O3S/c14-13(15,19)7-18-10(16)11-2-8-1-9(3-11)5-12(17,4-8)6-11/h8-9,17,19H,1-7H2 |
| InChIKey | OGVOZOWCBOPMMS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|