C22H30O3 — CID 5006139
(4-tert-butylphenyl)methyl 3-hydroxyadamantane-1-carboxylate (PubChem CID 5006139) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 3-hydroxyadamantane-1-carboxylate.
| Compound Name | (4-tert-butylphenyl)methyl 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 5006139 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (4-tert-butylphenyl)methyl 3-hydroxyadamantane-1-carboxylate |
| SMILES | CC(C)(C)c1ccc(COC(=O)C23CC4CC(CC(O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H30O3/c1-20(2,3)18-6-4-15(5-7-18)13-25-19(23)21-9-16-8-17(10-21)12-22(24,11-16)14-21/h4-7,16-17,24H,8-14H2,1-3H3 |
| InChIKey | WMQJSKYRZVXCEO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |