C19H23FO4 — CID 98294199
(3-fluoro-4-methoxyphenyl)methyl (5S,7S)-3-hydroxyadamantane-1-carboxylate (PubChem CID 98294199) has the molecular formula C19H23FO4 and a molecular weight of 334.39 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl (5S,7S)-3-hydroxyadamantane-1-carboxylate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl (5S,7S)-3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98294199 |
| Molecular Formula | C19H23FO4 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl (5S,7S)-3-hydroxyadamantane-1-carboxylate |
| SMILES | COc1ccc(COC(=O)C23C[C@@H]4C[C@H](CC(O)(C4)C2)C3)cc1F |
| InChI | InChI=1S/C19H23FO4/c1-23-16-3-2-12(5-15(16)20)10-24-17(21)18-6-13-4-14(7-18)9-19(22,8-13)11-18/h2-3,5,13-14,22H,4,6-11H2,1H3/t13-,14-,18?,19?/m0/s1 |
| InChIKey | WKFPWIKMBSLOTA-IHWOHKJGSA-N |
| XLogP | 3.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |