C21H24Cl2N2O5 — CID 98294656
[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] (5R,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 98294656) has the molecular formula C21H24Cl2N2O5 and a molecular weight of 455.34 g/mol. Its IUPAC name is [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] (5R,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] (5R,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98294656 |
| Molecular Formula | C21H24Cl2N2O5 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] (5R,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)COC(=O)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C21H24Cl2N2O5/c1-29-16-3-2-14(22)5-15(16)18(27)25-24-17(26)10-30-19(28)20-6-12-4-13(7-20)9-21(23,8-12)11-20/h2-3,5,12-13H,4,6-11H2,1H3,(H,24,26)(H,25,27)/t12-,13-,20?,21?/m1/s1 |
| InChIKey | CHPBYIBPNTXJOC-QQRKTFAASA-N |
| XLogP | 3.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|