C24H31NO5 — CID 45353088
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 45353088) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 45353088 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | CC(=O)NCCCc1ccc(C(=O)COC(=O)C23CC4CC(CC(O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H31NO5/c1-16(26)25-8-2-3-17-4-6-20(7-5-17)21(27)14-30-22(28)23-10-18-9-19(11-23)13-24(29,12-18)15-23/h4-7,18-19,29H,2-3,8-15H2,1H3,(H,25,26) |
| InChIKey | WBXJXZXFXHPCRE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|