C28H29NO4 — CID 46817553
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 46817553) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 46817553 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | CC(=O)NCCCc1ccc(C(=O)COC(=O)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29NO4/c1-21(30)29-18-8-9-22-14-16-25(17-15-22)27(31)20-33-28(32)19-26(23-10-4-2-5-11-23)24-12-6-3-7-13-24/h2-7,10-17,26H,8-9,18-20H2,1H3,(H,29,30) |
| InChIKey | SAKJXUKFZXSMLS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|