C24H22O3 — CID 23821920
[2-(4-methylphenyl)-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 23821920) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 23821920 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | Cc1ccc(C(=O)COC(=O)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22O3/c1-18-12-14-21(15-13-18)23(25)17-27-24(26)16-22(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,22H,16-17H2,1H3 |
| InChIKey | UXJBDWHSQFCOFE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |