About phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate
phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate (PubChem CID 175385549) has the molecular formula C19H18O5
and a molecular weight of 326.35 g/mol. Its IUPAC name is phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate.
Molecular Properties
| Compound Name | phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate |
| PubChem CID | 175385549 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate |
| SMILES | Cc1ccc(C(=O)CC(=O)OCOCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18O5/c1-14-7-9-16(10-8-14)17(20)11-19(22)24-13-23-12-18(21)15-5-3-2-4-6-15/h2-10H,11-13H2,1H3 |
| InChIKey | XKDJOBXGOMSZKH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate?
The IUPAC name of phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate (CID 175385549) is phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate.
What is the SMILES notation for phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate?
The canonical SMILES for phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate is Cc1ccc(C(=O)CC(=O)OCOCC(=O)c2ccccc2)cc1.
What is the InChIKey of phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate?
The InChIKey is XKDJOBXGOMSZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O5/c1-14-7-9-16(10-8-14)17(20)11-19(22)24-13-23-12-18(21)15-5-3-2-4-6-15/h2-10H,11-13H2,1H3.
What are the key properties of phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate?
phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate has a molecular weight of 326.35 g/mol, XLogP of 2.97, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyloxymethyl 3-(4-methylphenyl)-3-oxopropanoate is sourced from PubChem (CID 175385549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).