C24H24ClN3O4 — CID 32797220
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate (PubChem CID 32797220) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 32797220 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
| SMILES | CC(=O)NCCCc1ccc(C(=O)COC(=O)c2c(C)nn(-c3ccccc3)c2Cl)cc1 |
| InChI | InChI=1S/C24H24ClN3O4/c1-16-22(23(25)28(27-16)20-8-4-3-5-9-20)24(31)32-15-21(30)19-12-10-18(11-13-19)7-6-14-26-17(2)29/h3-5,8-13H,6-7,14-15H2,1-2H3,(H,26,29) |
| InChIKey | PSWVEAZGXMIWGL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|