C16H17ClN4O4 — CID 7557526
[2-(ethylcarbamoylamino)-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate (PubChem CID 7557526) has the molecular formula C16H17ClN4O4 and a molecular weight of 364.79 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7557526 |
| Molecular Formula | C16H17ClN4O4 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1c(C)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C16H17ClN4O4/c1-3-18-16(24)19-12(22)9-25-15(23)13-10(2)20-21(14(13)17)11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3,(H2,18,19,22,24) |
| InChIKey | LVKPVSGTGXTVHQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |