C18H19ClN4O4 — CID 7557374
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate (PubChem CID 7557374) has the molecular formula C18H19ClN4O4 and a molecular weight of 390.83 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7557374 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1c(C)nn(Cc2ccccc2)c1Cl |
| InChI | InChI=1S/C18H19ClN4O4/c1-3-9-20-18(26)21-14(24)11-27-17(25)15-12(2)22-23(16(15)19)10-13-7-5-4-6-8-13/h3-8H,1,9-11H2,2H3,(H2,20,21,24,26) |
| InChIKey | HCEHEPOQNRBBRV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|