C19H17ClN4O5 — CID 8575765
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate (PubChem CID 8575765) has the molecular formula C19H17ClN4O5 and a molecular weight of 416.82 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 8575765 |
| Molecular Formula | C19H17ClN4O5 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)OCC(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C19H17ClN4O5/c1-12-16(17(20)24(23-12)10-13-6-3-2-4-7-13)19(27)29-11-15(25)21-22-18(26)14-8-5-9-28-14/h2-9H,10-11H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | RKZVDMDLYWYRGK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|