C24H26ClN3O3 — CID 55365796
[2-oxo-2-(1-phenylbutylamino)ethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate (PubChem CID 55365796) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylbutylamino)ethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate.
| Compound Name | [2-oxo-2-(1-phenylbutylamino)ethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55365796 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [2-oxo-2-(1-phenylbutylamino)ethyl] 1-benzyl-5-chloro-3-methylpyrazole-4-carboxylate |
| SMILES | CCCC(NC(=O)COC(=O)c1c(C)nn(Cc2ccccc2)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-3-10-20(19-13-8-5-9-14-19)26-21(29)16-31-24(30)22-17(2)27-28(23(22)25)15-18-11-6-4-7-12-18/h4-9,11-14,20H,3,10,15-16H2,1-2H3,(H,26,29) |
| InChIKey | XNMPHXJBCCNIND-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |