C19H14Cl2N2O3 — CID 8576220
[2-(4-chlorophenyl)-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate (PubChem CID 8576220) has the molecular formula C19H14Cl2N2O3 and a molecular weight of 389.24 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 8576220 |
| Molecular Formula | C19H14Cl2N2O3 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)OCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O3/c1-12-17(18(21)23(22-12)15-5-3-2-4-6-15)19(25)26-11-16(24)13-7-9-14(20)10-8-13/h2-10H,11H2,1H3 |
| InChIKey | BSDLTLYOUOOOSX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |