C24H17ClN2O3 — CID 2400676
[2-(4-chlorophenyl)-2-oxoethyl] 1,3-diphenylpyrazole-5-carboxylate (PubChem CID 2400676) has the molecular formula C24H17ClN2O3 and a molecular weight of 416.86 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 1,3-diphenylpyrazole-5-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 1,3-diphenylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2400676 |
| Molecular Formula | C24H17ClN2O3 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 1,3-diphenylpyrazole-5-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccccc2)nn1-c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17ClN2O3/c25-19-13-11-18(12-14-19)23(28)16-30-24(29)22-15-21(17-7-3-1-4-8-17)26-27(22)20-9-5-2-6-10-20/h1-15H,16H2 |
| InChIKey | CBDXCLNVQAPQMX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |