C26H28N2O4 — CID 32763806
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate (PubChem CID 32763806) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 32763806 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 2-ethyl-3-methylquinoline-4-carboxylate |
| SMILES | CCc1nc2ccccc2c(C(=O)OCC(=O)c2ccc(CCCNC(C)=O)cc2)c1C |
| InChI | InChI=1S/C26H28N2O4/c1-4-22-17(2)25(21-9-5-6-10-23(21)28-22)26(31)32-16-24(30)20-13-11-19(12-14-20)8-7-15-27-18(3)29/h5-6,9-14H,4,7-8,15-16H2,1-3H3,(H,27,29) |
| InChIKey | DVJRKXNLTDAIEP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|