C25H27NO3 — CID 7501896
[2-(4-tert-butylphenyl)-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate (PubChem CID 7501896) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate.
| Compound Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7501896 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate |
| SMILES | CCc1nc2ccccc2c(C)c1C(=O)OCC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H27NO3/c1-6-20-23(16(2)19-9-7-8-10-21(19)26-20)24(28)29-15-22(27)17-11-13-18(14-12-17)25(3,4)5/h7-14H,6,15H2,1-5H3 |
| InChIKey | ASRVNRMOECMBKM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |