C23H23N3O4 — CID 8668101
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate (PubChem CID 8668101) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 8668101 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-ethyl-4-methylquinoline-3-carboxylate |
| SMILES | CCc1nc2ccccc2c(C)c1C(=O)OCC(=O)Nc1ccc(C(=O)NC)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-4-18-21(14(2)17-7-5-6-8-19(17)26-18)23(29)30-13-20(27)25-16-11-9-15(10-12-16)22(28)24-3/h5-12H,4,13H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | FLIMEUSWDSYKRO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |