C16H18N2O4 — CID 18149529
[2-(methylamino)-2-oxoethyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate (PubChem CID 18149529) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18149529 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
| SMILES | CNC(=O)COC(=O)c1c(COC)nc2ccccc2c1C |
| InChI | InChI=1S/C16H18N2O4/c1-10-11-6-4-5-7-12(11)18-13(8-21-3)15(10)16(20)22-9-14(19)17-2/h4-7H,8-9H2,1-3H3,(H,17,19) |
| InChIKey | KLKMDCDNYOOFGU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |