C17H19NO3 — CID 55563291
[(E)-but-2-enyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate (PubChem CID 55563291) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate.
| Compound Name | [(E)-but-2-enyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 55563291 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | [(E)-but-2-enyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
| SMILES | C/C=C/COC(=O)c1c(COC)nc2ccccc2c1C |
| InChI | InChI=1S/C17H19NO3/c1-4-5-10-21-17(19)16-12(2)13-8-6-7-9-14(13)18-15(16)11-20-3/h4-9H,10-11H2,1-3H3/b5-4+ |
| InChIKey | OJVGVUJAOYAKCC-SNAWJCMRSA-N |
| XLogP | 3.42 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|