C22H21NO3 — CID 46511818
[(E)-3-phenylprop-2-enyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate (PubChem CID 46511818) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 46511818 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
| SMILES | COCc1nc2ccccc2c(C)c1C(=O)OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H21NO3/c1-16-18-12-6-7-13-19(18)23-20(15-25-2)21(16)22(24)26-14-8-11-17-9-4-3-5-10-17/h3-13H,14-15H2,1-2H3/b11-8+ |
| InChIKey | LYIWQJOGWBBTRC-DHZHZOJOSA-N |
| XLogP | 4.56 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |