C17H18N2O3 — CID 46574583
3-cyanopropyl 2-(methoxymethyl)-4-methylquinoline-3-carboxylate (PubChem CID 46574583) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-cyanopropyl 2-(methoxymethyl)-4-methylquinoline-3-carboxylate.
| Compound Name | 3-cyanopropyl 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 46574583 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-cyanopropyl 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
| SMILES | COCc1nc2ccccc2c(C)c1C(=O)OCCCC#N |
| InChI | InChI=1S/C17H18N2O3/c1-12-13-7-3-4-8-14(13)19-15(11-21-2)16(12)17(20)22-10-6-5-9-18/h3-4,7-8H,5-6,10-11H2,1-2H3 |
| InChIKey | RRRFINGLRFMTRK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|