About 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate
3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate (PubChem CID 46675585) has the molecular formula C17H18N2O2
and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate |
| PubChem CID | 46675585 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate |
| SMILES | CC(C)c1cc(C(=O)OCCCC#N)c2ccccc2n1 |
| InChI | InChI=1S/C17H18N2O2/c1-12(2)16-11-14(17(20)21-10-6-5-9-18)13-7-3-4-8-15(13)19-16/h3-4,7-8,11-12H,5-6,10H2,1-2H3 |
| InChIKey | ABNZVIBCNAJYKC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate?
The IUPAC name of 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate (CID 46675585) is 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate.
What is the SMILES notation for 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate?
The canonical SMILES for 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate is CC(C)c1cc(C(=O)OCCCC#N)c2ccccc2n1.
What is the InChIKey of 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate?
The InChIKey is ABNZVIBCNAJYKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O2/c1-12(2)16-11-14(17(20)21-10-6-5-9-18)13-7-3-4-8-15(13)19-16/h3-4,7-8,11-12H,5-6,10H2,1-2H3.
What are the key properties of 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate?
3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate has a molecular weight of 282.34 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanopropyl 2-propan-2-ylquinoline-4-carboxylate is sourced from PubChem (CID 46675585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).