C26H27N3O4 — CID 27803008
[2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-propan-2-ylquinoline-4-carboxylate (PubChem CID 27803008) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-propan-2-ylquinoline-4-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-propan-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 27803008 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-propan-2-ylquinoline-4-carboxylate |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)COC(=O)c2cc(C(C)C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-4-32-20-12-10-19(11-13-20)29(15-7-14-27)25(30)17-33-26(31)22-16-24(18(2)3)28-23-9-6-5-8-21(22)23/h5-6,8-13,16,18H,4,7,15,17H2,1-3H3 |
| InChIKey | HBZNDUREYICCFG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |