C22H25N3O6S — CID 55326498
[2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate (PubChem CID 55326498) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55326498 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)COC(=O)C(C)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O6S/c1-3-30-19-12-10-18(11-13-19)25(15-7-14-23)21(26)16-31-22(27)17(2)24-32(28,29)20-8-5-4-6-9-20/h4-6,8-13,17,24H,3,7,15-16H2,1-2H3 |
| InChIKey | KVRBSUHBLFBOFH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |