C20H21N3O5S — CID 2123041
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(benzenesulfonamido)propanoate (PubChem CID 2123041) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(benzenesulfonamido)propanoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 2123041 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(benzenesulfonamido)propanoate |
| SMILES | N#CCCN(C(=O)COC(=O)CCNS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O5S/c21-13-7-15-23(17-8-3-1-4-9-17)19(24)16-28-20(25)12-14-22-29(26,27)18-10-5-2-6-11-18/h1-6,8-11,22H,7,12,14-16H2 |
| InChIKey | JEVOXDWRXIASRF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |