C26H23N3O3S — CID 2433979
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-phenothiazin-10-ylpropanoate (PubChem CID 2433979) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 2433979 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-phenothiazin-10-ylpropanoate |
| SMILES | N#CCCN(C(=O)COC(=O)CCN1c2ccccc2Sc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C26H23N3O3S/c27-16-8-17-28(20-9-2-1-3-10-20)25(30)19-32-26(31)15-18-29-21-11-4-6-13-23(21)33-24-14-7-5-12-22(24)29/h1-7,9-14H,8,15,17-19H2 |
| InChIKey | JMYVKZHQIDMMPY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|