C24H22N4OS — CID 134013361
N-(2-cyanoethyl)-3-phenothiazin-10-yl-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 134013361) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-phenothiazin-10-yl-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | N-(2-cyanoethyl)-3-phenothiazin-10-yl-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 134013361 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-(2-cyanoethyl)-3-phenothiazin-10-yl-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C24H22N4OS/c25-13-6-15-27(18-19-7-5-14-26-17-19)24(29)12-16-28-20-8-1-3-10-22(20)30-23-11-4-2-9-21(23)28/h1-5,7-11,14,17H,6,12,15-16,18H2 |
| InChIKey | KDZYLCXCEBXVQV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|