C20H19N5O2 — CID 86864871
N-(2-cyanoethyl)-3-(4-oxocinnolin-1-yl)-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 86864871) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-(4-oxocinnolin-1-yl)-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | N-(2-cyanoethyl)-3-(4-oxocinnolin-1-yl)-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 86864871 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(2-cyanoethyl)-3-(4-oxocinnolin-1-yl)-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)CCn1ncc(=O)c2ccccc21 |
| InChI | InChI=1S/C20H19N5O2/c21-9-4-11-24(15-16-5-3-10-22-13-16)20(27)8-12-25-18-7-2-1-6-17(18)19(26)14-23-25/h1-3,5-7,10,13-14H,4,8,11-12,15H2 |
| InChIKey | NLJXITGAONUAAJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |