C27H24ClN5O2S — CID 42734661
4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 42734661) has the molecular formula C27H24ClN5O2S and a molecular weight of 518.04 g/mol. Its IUPAC name is 4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 42734661 |
| Molecular Formula | C27H24ClN5O2S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 4-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)CCCSc1nc2ccccc2c(=O)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H24ClN5O2S/c28-21-8-3-9-22(17-21)33-26(35)23-10-1-2-11-24(23)31-27(33)36-16-5-12-25(34)32(15-6-13-29)19-20-7-4-14-30-18-20/h1-4,7-11,14,17-18H,5-6,12,15-16,19H2 |
| InChIKey | ITZAQVLLCUFKGR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|