C15H10N4OS — CID 17403779
2-(4-oxo-3-pyridin-3-ylquinazolin-2-yl)sulfanylacetonitrile (PubChem CID 17403779) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-(4-oxo-3-pyridin-3-ylquinazolin-2-yl)sulfanylacetonitrile.
| Compound Name | 2-(4-oxo-3-pyridin-3-ylquinazolin-2-yl)sulfanylacetonitrile |
|---|---|
| PubChem CID | 17403779 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(4-oxo-3-pyridin-3-ylquinazolin-2-yl)sulfanylacetonitrile |
| SMILES | N#CCSc1nc2ccccc2c(=O)n1-c1cccnc1 |
| InChI | InChI=1S/C15H10N4OS/c16-7-9-21-15-18-13-6-2-1-5-12(13)14(20)19(15)11-4-3-8-17-10-11/h1-6,8,10H,9H2 |
| InChIKey | GKVSTIVGERGPPY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |