C18H20N4O2S — CID 86864873
N-[4-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 86864873) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[4-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86864873 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[4-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)CCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C18H20N4O2S/c19-8-4-11-22(14-15-5-1-9-20-13-15)17(23)7-2-10-21-18(24)16-6-3-12-25-16/h1,3,5-6,9,12-13H,2,4,7,10-11,14H2,(H,21,24) |
| InChIKey | RDIKMEVVRCUIIA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|