C16H15N3OS2 — CID 43911955
N-[benzyl(2-cyanoethyl)carbamothioyl]thiophene-2-carboxamide (PubChem CID 43911955) has the molecular formula C16H15N3OS2 and a molecular weight of 329.45 g/mol. Its IUPAC name is N-[benzyl(2-cyanoethyl)carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[benzyl(2-cyanoethyl)carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 43911955 |
| Molecular Formula | C16H15N3OS2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-[benzyl(2-cyanoethyl)carbamothioyl]thiophene-2-carboxamide |
| SMILES | N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccs1 |
| InChI | InChI=1S/C16H15N3OS2/c17-9-5-10-19(12-13-6-2-1-3-7-13)16(21)18-15(20)14-8-4-11-22-14/h1-4,6-8,11H,5,10,12H2,(H,18,20,21) |
| InChIKey | USLFTPWMAKJDQE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|