C19H19N3OS2 — CID 54790300
(E)-N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 54790300) has the molecular formula C19H19N3OS2 and a molecular weight of 369.52 g/mol. Its IUPAC name is (E)-N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 54790300 |
| Molecular Formula | C19H19N3OS2 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (E)-N-[2-cyanoethyl(2-phenylethyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | N#CCCN(CCc1ccccc1)C(=S)NC(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C19H19N3OS2/c20-12-5-13-22(14-11-16-6-2-1-3-7-16)19(24)21-18(23)10-9-17-8-4-15-25-17/h1-4,6-10,15H,5,11,13-14H2,(H,21,23,24)/b10-9+ |
| InChIKey | FUOIGEQYYLYRAW-MDZDMXLPSA-N |
| XLogP | 3.62 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|