C20H18ClN3OS — CID 74906276
N-[benzyl(2-cyanoethyl)carbamothioyl]-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 74906276) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is N-[benzyl(2-cyanoethyl)carbamothioyl]-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | N-[benzyl(2-cyanoethyl)carbamothioyl]-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74906276 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-[benzyl(2-cyanoethyl)carbamothioyl]-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | N#CCCN(Cc1ccccc1)C(=S)NC(=O)C=Cc1ccccc1Cl |
| InChI | InChI=1S/C20H18ClN3OS/c21-18-10-5-4-9-17(18)11-12-19(25)23-20(26)24(14-6-13-22)15-16-7-2-1-3-8-16/h1-5,7-12H,6,14-15H2,(H,23,25,26) |
| InChIKey | UNELOKUVMIAUSZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|