C21H21ClN2O3S — CID 41483208
[2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 3-(2-chlorophenyl)sulfanylpropanoate (PubChem CID 41483208) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 3-(2-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 3-(2-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 41483208 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 3-(2-chlorophenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(N(CCC#N)C(=O)COC(=O)CCSc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O3S/c1-16-7-9-17(10-8-16)24(13-4-12-23)20(25)15-27-21(26)11-14-28-19-6-3-2-5-18(19)22/h2-3,5-10H,4,11,13-15H2,1H3 |
| InChIKey | SFRPHKMWKSUSFG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |