C19H16ClFN2O3 — CID 7503998
[2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 2-chloro-6-fluorobenzoate (PubChem CID 7503998) has the molecular formula C19H16ClFN2O3 and a molecular weight of 374.80 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 2-chloro-6-fluorobenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 7503998 |
| Molecular Formula | C19H16ClFN2O3 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 2-chloro-6-fluorobenzoate |
| SMILES | Cc1ccc(N(CCC#N)C(=O)COC(=O)c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H16ClFN2O3/c1-13-6-8-14(9-7-13)23(11-3-10-22)17(24)12-26-19(25)18-15(20)4-2-5-16(18)21/h2,4-9H,3,11-12H2,1H3 |
| InChIKey | MWSNRJAGBNFWRE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |