C18H15Cl3N2O2 — CID 7832719
N-(2-cyanoethyl)-N-(4-methylphenyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 7832719) has the molecular formula C18H15Cl3N2O2 and a molecular weight of 397.69 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(4-methylphenyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(2-cyanoethyl)-N-(4-methylphenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7832719 |
| Molecular Formula | C18H15Cl3N2O2 |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-(2-cyanoethyl)-N-(4-methylphenyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | Cc1ccc(N(CCC#N)C(=O)COc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H15Cl3N2O2/c1-12-3-5-13(6-4-12)23(8-2-7-22)18(24)11-25-17-10-15(20)14(19)9-16(17)21/h3-6,9-10H,2,8,11H2,1H3 |
| InChIKey | FOIFLBBCVUJNTC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|