C25H29N3O5S — CID 55315532
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(4-piperidin-1-ylsulfonylphenyl)propanoate (PubChem CID 55315532) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(4-piperidin-1-ylsulfonylphenyl)propanoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(4-piperidin-1-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 55315532 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-(4-piperidin-1-ylsulfonylphenyl)propanoate |
| SMILES | N#CCCN(C(=O)COC(=O)CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O5S/c26-16-7-19-28(22-8-3-1-4-9-22)24(29)20-33-25(30)15-12-21-10-13-23(14-11-21)34(31,32)27-17-5-2-6-18-27/h1,3-4,8-11,13-14H,2,5-7,12,15,17-20H2 |
| InChIKey | ZBCSMBNVRBVCLL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |