C23H34N2O7S — CID 42988744
ethyl 4-[[2-[3-[4-(azepan-1-ylsulfonyl)phenyl]propanoyloxy]acetyl]amino]butanoate (PubChem CID 42988744) has the molecular formula C23H34N2O7S and a molecular weight of 482.60 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[4-(azepan-1-ylsulfonyl)phenyl]propanoyloxy]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[3-[4-(azepan-1-ylsulfonyl)phenyl]propanoyloxy]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 42988744 |
| Molecular Formula | C23H34N2O7S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | ethyl 4-[[2-[3-[4-(azepan-1-ylsulfonyl)phenyl]propanoyloxy]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)CCc1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C23H34N2O7S/c1-2-31-22(27)8-7-15-24-21(26)18-32-23(28)14-11-19-9-12-20(13-10-19)33(29,30)25-16-5-3-4-6-17-25/h9-10,12-13H,2-8,11,14-18H2,1H3,(H,24,26) |
| InChIKey | OYTOEEHRLOPHNT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|