C23H34N2O7S — CID 29325206
[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 29325206) has the molecular formula C23H34N2O7S and a molecular weight of 482.60 g/mol. Its IUPAC name is [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 29325206 |
| Molecular Formula | C23H34N2O7S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)C1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H34N2O7S/c1-4-31-22(27)6-5-13-24-21(26)16-32-23(28)19-11-14-25(15-12-19)33(29,30)20-9-7-18(8-10-20)17(2)3/h7-10,17,19H,4-6,11-16H2,1-3H3,(H,24,26) |
| InChIKey | IFEVFIRENJDQQA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|