C25H24N2O3S — CID 4648149
[2-oxo-2-(1-phenylethylamino)ethyl] 3-phenothiazin-10-ylpropanoate (PubChem CID 4648149) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 3-phenothiazin-10-ylpropanoate.
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 3-phenothiazin-10-ylpropanoate |
|---|---|
| PubChem CID | 4648149 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 3-phenothiazin-10-ylpropanoate |
| SMILES | CC(NC(=O)COC(=O)CCN1c2ccccc2Sc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O3S/c1-18(19-9-3-2-4-10-19)26-24(28)17-30-25(29)15-16-27-20-11-5-7-13-22(20)31-23-14-8-6-12-21(23)27/h2-14,18H,15-17H2,1H3,(H,26,28) |
| InChIKey | QCAFDAUYEFXQLV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|