C20H19NO3 — CID 18144423
benzyl 2-(methoxymethyl)-4-methylquinoline-3-carboxylate (PubChem CID 18144423) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is benzyl 2-(methoxymethyl)-4-methylquinoline-3-carboxylate.
| Compound Name | benzyl 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18144423 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | benzyl 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
| SMILES | COCc1nc2ccccc2c(C)c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c1-14-16-10-6-7-11-17(16)21-18(13-23-2)19(14)20(22)24-12-15-8-4-3-5-9-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | RTMAKAXARVAKHF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |