C21H18ClN3O6 — CID 30688302
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate (PubChem CID 30688302) has the molecular formula C21H18ClN3O6 and a molecular weight of 443.84 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 30688302 |
| Molecular Formula | C21H18ClN3O6 |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(methoxymethyl)-4-methylquinoline-3-carboxylate |
| SMILES | COCc1nc2ccccc2c(C)c1C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H18ClN3O6/c1-12-14-5-3-4-6-16(14)23-18(10-30-2)20(12)21(27)31-11-19(26)24-17-8-7-13(25(28)29)9-15(17)22/h3-9H,10-11H2,1-2H3,(H,24,26) |
| InChIKey | XWWGQYKZHQCBGG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|